C13H18N2O4 — CID 114343978
(2,3-dihydroxyphenyl)-[4-(2-hydroxyethyl)piperazin-1-yl]methanone (PubChem CID 114343978) has the molecular formula C13H18N2O4 and a molecular weight of 266.30 g/mol. Its IUPAC name is (2,3-dihydroxyphenyl)-[4-(2-hydroxyethyl)piperazin-1-yl]methanone.
| Compound Name | (2,3-dihydroxyphenyl)-[4-(2-hydroxyethyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 114343978 |
| Molecular Formula | C13H18N2O4 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | (2,3-dihydroxyphenyl)-[4-(2-hydroxyethyl)piperazin-1-yl]methanone |
| SMILES | O=C(c1cccc(O)c1O)N1CCN(CCO)CC1 |
| InChI | InChI=1S/C13H18N2O4/c16-9-8-14-4-6-15(7-5-14)13(19)10-2-1-3-11(17)12(10)18/h1-3,16-18H,4-9H2 |
| InChIKey | FEPPIAONYRWNSB-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|