C14H20N2O4 — CID 114344226
N-[3-(butan-2-ylamino)-3-oxopropyl]-2,3-dihydroxybenzamide (PubChem CID 114344226) has the molecular formula C14H20N2O4 and a molecular weight of 280.32 g/mol. Its IUPAC name is N-[3-(butan-2-ylamino)-3-oxopropyl]-2,3-dihydroxybenzamide.
| Compound Name | N-[3-(butan-2-ylamino)-3-oxopropyl]-2,3-dihydroxybenzamide |
|---|---|
| PubChem CID | 114344226 |
| Molecular Formula | C14H20N2O4 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | N-[3-(butan-2-ylamino)-3-oxopropyl]-2,3-dihydroxybenzamide |
| SMILES | CCC(C)NC(=O)CCNC(=O)c1cccc(O)c1O |
| InChI | InChI=1S/C14H20N2O4/c1-3-9(2)16-12(18)7-8-15-14(20)10-5-4-6-11(17)13(10)19/h4-6,9,17,19H,3,7-8H2,1-2H3,(H,15,20)(H,16,18) |
| InChIKey | PXBJOSCWABZZAF-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|