C14H21N3O3 — CID 114345025
2,3-dihydroxy-N-methyl-N-(2-piperazin-1-ylethyl)benzamide (PubChem CID 114345025) has the molecular formula C14H21N3O3 and a molecular weight of 279.34 g/mol. Its IUPAC name is 2,3-dihydroxy-N-methyl-N-(2-piperazin-1-ylethyl)benzamide.
| Compound Name | 2,3-dihydroxy-N-methyl-N-(2-piperazin-1-ylethyl)benzamide |
|---|---|
| PubChem CID | 114345025 |
| Molecular Formula | C14H21N3O3 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | 2,3-dihydroxy-N-methyl-N-(2-piperazin-1-ylethyl)benzamide |
| SMILES | CN(CCN1CCNCC1)C(=O)c1cccc(O)c1O |
| InChI | InChI=1S/C14H21N3O3/c1-16(9-10-17-7-5-15-6-8-17)14(20)11-3-2-4-12(18)13(11)19/h2-4,15,18-19H,5-10H2,1H3 |
| InChIKey | MDJHXJYGLIJTDB-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 76.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|