C13H19N3O3 — CID 114345098
[2-(aminomethyl)-4-methylpiperazin-1-yl]-(2,3-dihydroxyphenyl)methanone (PubChem CID 114345098) has the molecular formula C13H19N3O3 and a molecular weight of 265.31 g/mol. Its IUPAC name is [2-(aminomethyl)-4-methylpiperazin-1-yl]-(2,3-dihydroxyphenyl)methanone.
| Compound Name | [2-(aminomethyl)-4-methylpiperazin-1-yl]-(2,3-dihydroxyphenyl)methanone |
|---|---|
| PubChem CID | 114345098 |
| Molecular Formula | C13H19N3O3 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.14 |
| IUPAC Name | [2-(aminomethyl)-4-methylpiperazin-1-yl]-(2,3-dihydroxyphenyl)methanone |
| SMILES | CN1CCN(C(=O)c2cccc(O)c2O)C(CN)C1 |
| InChI | InChI=1S/C13H19N3O3/c1-15-5-6-16(9(7-14)8-15)13(19)10-3-2-4-11(17)12(10)18/h2-4,9,17-18H,5-8,14H2,1H3 |
| InChIKey | UBCCJVDXXVVRFI-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|