C17H14FNO2 — CID 114346298
1-[(4-fluoro-2-methylphenyl)methyl]indole-3-carboxylic acid (PubChem CID 114346298) has the molecular formula C17H14FNO2 and a molecular weight of 283.30 g/mol. Its IUPAC name is 1-[(4-fluoro-2-methylphenyl)methyl]indole-3-carboxylic acid.
| Compound Name | 1-[(4-fluoro-2-methylphenyl)methyl]indole-3-carboxylic acid |
|---|---|
| PubChem CID | 114346298 |
| Molecular Formula | C17H14FNO2 |
| Molecular Weight | 283.30 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | 1-[(4-fluoro-2-methylphenyl)methyl]indole-3-carboxylic acid |
| SMILES | Cc1cc(F)ccc1Cn1cc(C(=O)O)c2ccccc21 |
| InChI | InChI=1S/C17H14FNO2/c1-11-8-13(18)7-6-12(11)9-19-10-15(17(20)21)14-4-2-3-5-16(14)19/h2-8,10H,9H2,1H3,(H,20,21) |
| InChIKey | WSWLHFMTEFJPHD-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.30 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |