C14H19FO — CID 114347218
1-(4-fluoro-2-methylphenyl)-4,4-dimethylpentan-2-one (PubChem CID 114347218) has the molecular formula C14H19FO and a molecular weight of 222.30 g/mol. Its IUPAC name is 1-(4-fluoro-2-methylphenyl)-4,4-dimethylpentan-2-one.
| Compound Name | 1-(4-fluoro-2-methylphenyl)-4,4-dimethylpentan-2-one |
|---|---|
| PubChem CID | 114347218 |
| Molecular Formula | C14H19FO |
| Molecular Weight | 222.30 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | 1-(4-fluoro-2-methylphenyl)-4,4-dimethylpentan-2-one |
| SMILES | Cc1cc(F)ccc1CC(=O)CC(C)(C)C |
| InChI | InChI=1S/C14H19FO/c1-10-7-12(15)6-5-11(10)8-13(16)9-14(2,3)4/h5-7H,8-9H2,1-4H3 |
| InChIKey | BTJDTZQCQHVDJB-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.30 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |