C17H20FN — CID 114347745
1-(4-fluoro-2-methylphenyl)-4-phenylbutan-2-amine (PubChem CID 114347745) has the molecular formula C17H20FN and a molecular weight of 257.35 g/mol. Its IUPAC name is 1-(4-fluoro-2-methylphenyl)-4-phenylbutan-2-amine.
| Compound Name | 1-(4-fluoro-2-methylphenyl)-4-phenylbutan-2-amine |
|---|---|
| PubChem CID | 114347745 |
| Molecular Formula | C17H20FN |
| Molecular Weight | 257.35 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | 1-(4-fluoro-2-methylphenyl)-4-phenylbutan-2-amine |
| SMILES | Cc1cc(F)ccc1CC(N)CCc1ccccc1 |
| InChI | InChI=1S/C17H20FN/c1-13-11-16(18)9-8-15(13)12-17(19)10-7-14-5-3-2-4-6-14/h2-6,8-9,11,17H,7,10,12,19H2,1H3 |
| InChIKey | URIBZODRLFAXQO-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.35 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |