C56H67FeN19O9+2 — CID 11434786
CID 11434786 (PubChem CID 11434786) has the molecular formula C56H67FeN19O9+2 and a molecular weight of 1206.12 g/mol.
| Compound Name | CID 11434786 |
|---|---|
| PubChem CID | 11434786 |
| Molecular Formula | C56H67FeN19O9+2 |
| Molecular Weight | 1206.12 g/mol |
| Exact Mass | 1205.47 |
| IUPAC Name | — |
| SMILES | CN(C)CCCNC(=O)c1cc(NC(=O)c2nc(NC(=O)c3cc(NC(=O)CCCNC(=O)[C]4[CH][CH][CH][CH]4)cn3C)cn2C)cn1C.Cn1cc(NC(=O)c2nccn2C)cc1C(=O)Nc1cn(C)c(C(=O)NCCNC(=O)[C]2[CH][CH][CH][CH]2)n1.[Fe+2] |
| InChI | InChI=1S/C32H41N10O5.C24H26N9O4.Fe/c1-39(2)15-9-14-34-30(45)24-17-23(19-40(24)3)36-32(47)28-37-26(20-42(28)5)38-31(46)25-16-22(18-41(25)4)35-27(43)12-8-13-33-29(44)21-10-6-7-11-21;1-31-11-10-25-19(31)24(37)28-16-12-17(32(2)13-16)22(35)30-18-14-33(3)20(29-18)23(36)27-9-8-26-21(34)15-6-4-5-7-15;/h6-7,10-11,16-20H,8-9,12-15H2,1-5H3,(H,33,44)(H,34,45)(H,35,43)(H,36,47)(H,38,46);4-7,10-14H,8-9H2,1-3H3,(H,26,34)(H,27,36)(H,28,37)(H,30,35);/q;;+2 |
| InChIKey | MVKVBAYTTJKDJZ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 333.39 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 85 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1206.12 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|