C13H19ClFN — CID 114349189
2-chloro-N-[(4-fluoro-2-methylphenyl)methyl]-3-methylbutan-1-amine (PubChem CID 114349189) has the molecular formula C13H19ClFN and a molecular weight of 243.75 g/mol. Its IUPAC name is 2-chloro-N-[(4-fluoro-2-methylphenyl)methyl]-3-methylbutan-1-amine.
| Compound Name | 2-chloro-N-[(4-fluoro-2-methylphenyl)methyl]-3-methylbutan-1-amine |
|---|---|
| PubChem CID | 114349189 |
| Molecular Formula | C13H19ClFN |
| Molecular Weight | 243.75 g/mol |
| Exact Mass | 243.12 |
| IUPAC Name | 2-chloro-N-[(4-fluoro-2-methylphenyl)methyl]-3-methylbutan-1-amine |
| SMILES | Cc1cc(F)ccc1CNCC(Cl)C(C)C |
| InChI | InChI=1S/C13H19ClFN/c1-9(2)13(14)8-16-7-11-4-5-12(15)6-10(11)3/h4-6,9,13,16H,7-8H2,1-3H3 |
| InChIKey | FOMFJXSXZONESU-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.75 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|