About 3-methyl-4,5-dihydro-1,2-oxazole-5-carbonitrile
3-methyl-4,5-dihydro-1,2-oxazole-5-carbonitrile (PubChem CID 11434924) has the molecular formula C5H6N2O
and a molecular weight of 110.12 g/mol. Its IUPAC name is 3-methyl-4,5-dihydro-1,2-oxazole-5-carbonitrile.
Molecular Properties
| Compound Name | 3-methyl-4,5-dihydro-1,2-oxazole-5-carbonitrile |
| PubChem CID | 11434924 |
| Molecular Formula | C5H6N2O |
| Molecular Weight | 110.12 g/mol |
| Exact Mass | 110.05 |
| IUPAC Name | 3-methyl-4,5-dihydro-1,2-oxazole-5-carbonitrile |
| SMILES | CC1=NOC(C#N)C1 |
| InChI | InChI=1S/C5H6N2O/c1-4-2-5(3-6)8-7-4/h5H,2H2,1H3 |
| InChIKey | TYIDIIXKMCEOHC-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 45.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 110.12 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-methyl-4,5-dihydro-1,2-oxazole-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-4,5-dihydro-1,2-oxazole-5-carbonitrile?
The IUPAC name of 3-methyl-4,5-dihydro-1,2-oxazole-5-carbonitrile (CID 11434924) is 3-methyl-4,5-dihydro-1,2-oxazole-5-carbonitrile.
What is the SMILES notation for 3-methyl-4,5-dihydro-1,2-oxazole-5-carbonitrile?
The canonical SMILES for 3-methyl-4,5-dihydro-1,2-oxazole-5-carbonitrile is CC1=NOC(C#N)C1.
What is the InChIKey of 3-methyl-4,5-dihydro-1,2-oxazole-5-carbonitrile?
The InChIKey is TYIDIIXKMCEOHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N2O/c1-4-2-5(3-6)8-7-4/h5H,2H2,1H3.
What are the key properties of 3-methyl-4,5-dihydro-1,2-oxazole-5-carbonitrile?
3-methyl-4,5-dihydro-1,2-oxazole-5-carbonitrile has a molecular weight of 110.12 g/mol, XLogP of 0.67, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-4,5-dihydro-1,2-oxazole-5-carbonitrile is sourced from PubChem (CID 11434924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).