C8H7NO — CID 11434972
(2S,4R)-3-oxa-7-azatricyclo[4.4.0.02,4]deca-1(6),7,9-triene (PubChem CID 11434972) has the molecular formula C8H7NO and a molecular weight of 133.15 g/mol. Its IUPAC name is (2S,4R)-3-oxa-7-azatricyclo[4.4.0.02,4]deca-1(6),7,9-triene.
| Compound Name | (2S,4R)-3-oxa-7-azatricyclo[4.4.0.02,4]deca-1(6),7,9-triene |
|---|---|
| PubChem CID | 11434972 |
| Molecular Formula | C8H7NO |
| Molecular Weight | 133.15 g/mol |
| Exact Mass | 133.05 |
| IUPAC Name | (2S,4R)-3-oxa-7-azatricyclo[4.4.0.02,4]deca-1(6),7,9-triene |
| SMILES | c1cnc2c(c1)[C@@H]1O[C@@H]1C2 |
| InChI | InChI=1S/C8H7NO/c1-2-5-6(9-3-1)4-7-8(5)10-7/h1-3,7-8H,4H2/t7-,8+/m1/s1 |
| InChIKey | WYZPIDGMAJDVRC-SFYZADRCSA-N |
| XLogP | 1.08 |
| TPSA | 25.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 133.15 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|