C14H17ClN2O4 — CID 114351786
1-[2-(5-chloro-2-methylanilino)-2-oxoethyl]-4-hydroxypyrrolidine-2-carboxylic acid (PubChem CID 114351786) has the molecular formula C14H17ClN2O4 and a molecular weight of 312.75 g/mol. Its IUPAC name is 1-[2-(5-chloro-2-methylanilino)-2-oxoethyl]-4-hydroxypyrrolidine-2-carboxylic acid.
| Compound Name | 1-[2-(5-chloro-2-methylanilino)-2-oxoethyl]-4-hydroxypyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 114351786 |
| Molecular Formula | C14H17ClN2O4 |
| Molecular Weight | 312.75 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | 1-[2-(5-chloro-2-methylanilino)-2-oxoethyl]-4-hydroxypyrrolidine-2-carboxylic acid |
| SMILES | Cc1ccc(Cl)cc1NC(=O)CN1CC(O)CC1C(=O)O |
| InChI | InChI=1S/C14H17ClN2O4/c1-8-2-3-9(15)4-11(8)16-13(19)7-17-6-10(18)5-12(17)14(20)21/h2-4,10,12,18H,5-7H2,1H3,(H,16,19)(H,20,21) |
| InChIKey | OQDCZINSSFRXRG-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.75 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |