C7H11N5S — CID 114352159
N-methyl-3-([1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)propan-1-amine (PubChem CID 114352159) has the molecular formula C7H11N5S and a molecular weight of 197.27 g/mol. Its IUPAC name is N-methyl-3-([1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)propan-1-amine.
| Compound Name | N-methyl-3-([1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)propan-1-amine |
|---|---|
| PubChem CID | 114352159 |
| Molecular Formula | C7H11N5S |
| Molecular Weight | 197.27 g/mol |
| Exact Mass | 197.07 |
| IUPAC Name | N-methyl-3-([1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)propan-1-amine |
| SMILES | CNCCCc1nn2cnnc2s1 |
| InChI | InChI=1S/C7H11N5S/c1-8-4-2-3-6-11-12-5-9-10-7(12)13-6/h5,8H,2-4H2,1H3 |
| InChIKey | RDDGCHIEZFKOIK-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 55.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.27 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|