C11H13F3N4O2S — CID 114352712
2,3-dimethyl-2-[[3-(trifluoromethyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]methyl]butanoic acid (PubChem CID 114352712) has the molecular formula C11H13F3N4O2S and a molecular weight of 322.31 g/mol. Its IUPAC name is 2,3-dimethyl-2-[[3-(trifluoromethyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]methyl]butanoic acid.
| Compound Name | 2,3-dimethyl-2-[[3-(trifluoromethyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]methyl]butanoic acid |
|---|---|
| PubChem CID | 114352712 |
| Molecular Formula | C11H13F3N4O2S |
| Molecular Weight | 322.31 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | 2,3-dimethyl-2-[[3-(trifluoromethyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]methyl]butanoic acid |
| SMILES | CC(C)C(C)(Cc1nn2c(C(F)(F)F)nnc2s1)C(=O)O |
| InChI | InChI=1S/C11H13F3N4O2S/c1-5(2)10(3,8(19)20)4-6-17-18-7(11(12,13)14)15-16-9(18)21-6/h5H,4H2,1-3H3,(H,19,20) |
| InChIKey | CXVNSWKKZMRDMA-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 80.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.31 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |