C9H9F3N4O2S — CID 114352721
5-[3-(trifluoromethyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]pentanoic acid (PubChem CID 114352721) has the molecular formula C9H9F3N4O2S and a molecular weight of 294.26 g/mol. Its IUPAC name is 5-[3-(trifluoromethyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]pentanoic acid.
| Compound Name | 5-[3-(trifluoromethyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]pentanoic acid |
|---|---|
| PubChem CID | 114352721 |
| Molecular Formula | C9H9F3N4O2S |
| Molecular Weight | 294.26 g/mol |
| Exact Mass | 294.04 |
| IUPAC Name | 5-[3-(trifluoromethyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]pentanoic acid |
| SMILES | O=C(O)CCCCc1nn2c(C(F)(F)F)nnc2s1 |
| InChI | InChI=1S/C9H9F3N4O2S/c10-9(11,12)7-13-14-8-16(7)15-5(19-8)3-1-2-4-6(17)18/h1-4H2,(H,17,18) |
| InChIKey | ZVOPWSYTZYSUCV-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 80.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.26 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|