C11H7N7OS — CID 114353319
4-(3-phenyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)-1,2,5-oxadiazol-3-amine (PubChem CID 114353319) has the molecular formula C11H7N7OS and a molecular weight of 285.29 g/mol. Its IUPAC name is 4-(3-phenyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)-1,2,5-oxadiazol-3-amine.
| Compound Name | 4-(3-phenyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)-1,2,5-oxadiazol-3-amine |
|---|---|
| PubChem CID | 114353319 |
| Molecular Formula | C11H7N7OS |
| Molecular Weight | 285.29 g/mol |
| Exact Mass | 285.04 |
| IUPAC Name | 4-(3-phenyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)-1,2,5-oxadiazol-3-amine |
| SMILES | Nc1nonc1-c1nn2c(-c3ccccc3)nnc2s1 |
| InChI | InChI=1S/C11H7N7OS/c12-8-7(16-19-17-8)10-15-18-9(13-14-11(18)20-10)6-4-2-1-3-5-6/h1-5H,(H2,12,17) |
| InChIKey | KANZKYFRFWLKIE-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 108.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.29 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |