C11H19N5OS — CID 114354523
4-methoxy-1-(3-propan-2-yl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)butan-1-amine (PubChem CID 114354523) has the molecular formula C11H19N5OS and a molecular weight of 269.37 g/mol. Its IUPAC name is 4-methoxy-1-(3-propan-2-yl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)butan-1-amine.
| Compound Name | 4-methoxy-1-(3-propan-2-yl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)butan-1-amine |
|---|---|
| PubChem CID | 114354523 |
| Molecular Formula | C11H19N5OS |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | 4-methoxy-1-(3-propan-2-yl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)butan-1-amine |
| SMILES | COCCCC(N)c1nn2c(C(C)C)nnc2s1 |
| InChI | InChI=1S/C11H19N5OS/c1-7(2)9-13-14-11-16(9)15-10(18-11)8(12)5-4-6-17-3/h7-8H,4-6,12H2,1-3H3 |
| InChIKey | SGYOZLFMWJDIPY-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 78.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|