C13H15N5S — CID 114354615
4-methyl-3-(3-propan-2-yl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)aniline (PubChem CID 114354615) has the molecular formula C13H15N5S and a molecular weight of 273.37 g/mol. Its IUPAC name is 4-methyl-3-(3-propan-2-yl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)aniline.
| Compound Name | 4-methyl-3-(3-propan-2-yl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)aniline |
|---|---|
| PubChem CID | 114354615 |
| Molecular Formula | C13H15N5S |
| Molecular Weight | 273.37 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | 4-methyl-3-(3-propan-2-yl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)aniline |
| SMILES | Cc1ccc(N)cc1-c1nn2c(C(C)C)nnc2s1 |
| InChI | InChI=1S/C13H15N5S/c1-7(2)11-15-16-13-18(11)17-12(19-13)10-6-9(14)5-4-8(10)3/h4-7H,14H2,1-3H3 |
| InChIKey | YHCFIQUXTMLVOJ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 69.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.37 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|