C11H12N6OS2 — CID 114354824
4-[3-(oxan-4-yl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]-1,3-thiazol-2-amine (PubChem CID 114354824) has the molecular formula C11H12N6OS2 and a molecular weight of 308.39 g/mol. Its IUPAC name is 4-[3-(oxan-4-yl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]-1,3-thiazol-2-amine.
| Compound Name | 4-[3-(oxan-4-yl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 114354824 |
| Molecular Formula | C11H12N6OS2 |
| Molecular Weight | 308.39 g/mol |
| Exact Mass | 308.05 |
| IUPAC Name | 4-[3-(oxan-4-yl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]-1,3-thiazol-2-amine |
| SMILES | Nc1nc(-c2nn3c(C4CCOCC4)nnc3s2)cs1 |
| InChI | InChI=1S/C11H12N6OS2/c12-10-13-7(5-19-10)9-16-17-8(14-15-11(17)20-9)6-1-3-18-4-2-6/h5-6H,1-4H2,(H2,12,13) |
| InChIKey | ZAEBUMOONUAOLD-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.39 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |