C13H13N5O2S — CID 114355158
2-[3-(methoxymethyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]-3,4-dihydro-2H-1,4-benzoxazine (PubChem CID 114355158) has the molecular formula C13H13N5O2S and a molecular weight of 303.35 g/mol. Its IUPAC name is 2-[3-(methoxymethyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]-3,4-dihydro-2H-1,4-benzoxazine.
| Compound Name | 2-[3-(methoxymethyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]-3,4-dihydro-2H-1,4-benzoxazine |
|---|---|
| PubChem CID | 114355158 |
| Molecular Formula | C13H13N5O2S |
| Molecular Weight | 303.35 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | 2-[3-(methoxymethyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]-3,4-dihydro-2H-1,4-benzoxazine |
| SMILES | COCc1nnc2sc(C3CNc4ccccc4O3)nn12 |
| InChI | InChI=1S/C13H13N5O2S/c1-19-7-11-15-16-13-18(11)17-12(21-13)10-6-14-8-4-2-3-5-9(8)20-10/h2-5,10,14H,6-7H2,1H3 |
| InChIKey | RZOHHULQMIJJEP-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 73.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.35 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |