C14H23N5S — CID 114355934
5-(3-cyclobutyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)-3,3-dimethylpentan-1-amine (PubChem CID 114355934) has the molecular formula C14H23N5S and a molecular weight of 293.44 g/mol. Its IUPAC name is 5-(3-cyclobutyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)-3,3-dimethylpentan-1-amine.
| Compound Name | 5-(3-cyclobutyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)-3,3-dimethylpentan-1-amine |
|---|---|
| PubChem CID | 114355934 |
| Molecular Formula | C14H23N5S |
| Molecular Weight | 293.44 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | 5-(3-cyclobutyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)-3,3-dimethylpentan-1-amine |
| SMILES | CC(C)(CCN)CCc1nn2c(C3CCC3)nnc2s1 |
| InChI | InChI=1S/C14H23N5S/c1-14(2,8-9-15)7-6-11-18-19-12(10-4-3-5-10)16-17-13(19)20-11/h10H,3-9,15H2,1-2H3 |
| InChIKey | WDKUOTPLSKUSIH-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 69.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.44 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |