C7H9ClN4OS — CID 114356000
6-(1-chloroethyl)-3-(methoxymethyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole (PubChem CID 114356000) has the molecular formula C7H9ClN4OS and a molecular weight of 232.70 g/mol. Its IUPAC name is 6-(1-chloroethyl)-3-(methoxymethyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole.
| Compound Name | 6-(1-chloroethyl)-3-(methoxymethyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
|---|---|
| PubChem CID | 114356000 |
| Molecular Formula | C7H9ClN4OS |
| Molecular Weight | 232.70 g/mol |
| Exact Mass | 232.02 |
| IUPAC Name | 6-(1-chloroethyl)-3-(methoxymethyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
| SMILES | COCc1nnc2sc(C(C)Cl)nn12 |
| InChI | InChI=1S/C7H9ClN4OS/c1-4(8)6-11-12-5(3-13-2)9-10-7(12)14-6/h4H,3H2,1-2H3 |
| InChIKey | AGLNRLGBXQKRNF-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 52.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.70 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|