C8H8N4O2S — CID 114356284
3-(oxolan-2-yl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole-6-carbaldehyde (PubChem CID 114356284) has the molecular formula C8H8N4O2S and a molecular weight of 224.24 g/mol. Its IUPAC name is 3-(oxolan-2-yl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole-6-carbaldehyde.
| Compound Name | 3-(oxolan-2-yl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole-6-carbaldehyde |
|---|---|
| PubChem CID | 114356284 |
| Molecular Formula | C8H8N4O2S |
| Molecular Weight | 224.24 g/mol |
| Exact Mass | 224.04 |
| IUPAC Name | 3-(oxolan-2-yl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole-6-carbaldehyde |
| SMILES | O=Cc1nn2c(C3CCCO3)nnc2s1 |
| InChI | InChI=1S/C8H8N4O2S/c13-4-6-11-12-7(5-2-1-3-14-5)9-10-8(12)15-6/h4-5H,1-3H2 |
| InChIKey | JVGGICWIZPUBPV-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 69.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.24 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|