C9H17F4NO2 — CID 114358135
3-amino-2-(2,2,3,3-tetrafluoropropoxy)hexan-1-ol (PubChem CID 114358135) has the molecular formula C9H17F4NO2 and a molecular weight of 247.23 g/mol. Its IUPAC name is 3-amino-2-(2,2,3,3-tetrafluoropropoxy)hexan-1-ol.
| Compound Name | 3-amino-2-(2,2,3,3-tetrafluoropropoxy)hexan-1-ol |
|---|---|
| PubChem CID | 114358135 |
| Molecular Formula | C9H17F4NO2 |
| Molecular Weight | 247.23 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | 3-amino-2-(2,2,3,3-tetrafluoropropoxy)hexan-1-ol |
| SMILES | CCCC(N)C(CO)OCC(F)(F)C(F)F |
| InChI | InChI=1S/C9H17F4NO2/c1-2-3-6(14)7(4-15)16-5-9(12,13)8(10)11/h6-8,15H,2-5,14H2,1H3 |
| InChIKey | WIVSKLOJGBYOIQ-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.23 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|