C10H19F4NO2 — CID 114358138
3-amino-4,4-dimethyl-2-(2,2,3,3-tetrafluoropropoxy)pentan-1-ol (PubChem CID 114358138) has the molecular formula C10H19F4NO2 and a molecular weight of 261.26 g/mol. Its IUPAC name is 3-amino-4,4-dimethyl-2-(2,2,3,3-tetrafluoropropoxy)pentan-1-ol.
| Compound Name | 3-amino-4,4-dimethyl-2-(2,2,3,3-tetrafluoropropoxy)pentan-1-ol |
|---|---|
| PubChem CID | 114358138 |
| Molecular Formula | C10H19F4NO2 |
| Molecular Weight | 261.26 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | 3-amino-4,4-dimethyl-2-(2,2,3,3-tetrafluoropropoxy)pentan-1-ol |
| SMILES | CC(C)(C)C(N)C(CO)OCC(F)(F)C(F)F |
| InChI | InChI=1S/C10H19F4NO2/c1-9(2,3)7(15)6(4-16)17-5-10(13,14)8(11)12/h6-8,16H,4-5,15H2,1-3H3 |
| InChIKey | JLKBFMMIUOCIPM-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.26 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|