About 3-amino-4-methyl-2-(1,1,1-trifluoropropan-2-yloxy)pentan-1-ol
3-amino-4-methyl-2-(1,1,1-trifluoropropan-2-yloxy)pentan-1-ol (PubChem CID 114358327) has the molecular formula C9H18F3NO2
and a molecular weight of 229.24 g/mol. Its IUPAC name is 3-amino-4-methyl-2-(1,1,1-trifluoropropan-2-yloxy)pentan-1-ol.
Molecular Properties
| Compound Name | 3-amino-4-methyl-2-(1,1,1-trifluoropropan-2-yloxy)pentan-1-ol |
| PubChem CID | 114358327 |
| Molecular Formula | C9H18F3NO2 |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.13 |
| IUPAC Name | 3-amino-4-methyl-2-(1,1,1-trifluoropropan-2-yloxy)pentan-1-ol |
| SMILES | CC(C)C(N)C(CO)OC(C)C(F)(F)F |
| InChI | InChI=1S/C9H18F3NO2/c1-5(2)8(13)7(4-14)15-6(3)9(10,11)12/h5-8,14H,4,13H2,1-3H3 |
| InChIKey | VHDSKFXVPKJKCW-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-amino-4-methyl-2-(1,1,1-trifluoropropan-2-yloxy)pentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-4-methyl-2-(1,1,1-trifluoropropan-2-yloxy)pentan-1-ol?
The IUPAC name of 3-amino-4-methyl-2-(1,1,1-trifluoropropan-2-yloxy)pentan-1-ol (CID 114358327) is 3-amino-4-methyl-2-(1,1,1-trifluoropropan-2-yloxy)pentan-1-ol.
What is the SMILES notation for 3-amino-4-methyl-2-(1,1,1-trifluoropropan-2-yloxy)pentan-1-ol?
The canonical SMILES for 3-amino-4-methyl-2-(1,1,1-trifluoropropan-2-yloxy)pentan-1-ol is CC(C)C(N)C(CO)OC(C)C(F)(F)F.
What is the InChIKey of 3-amino-4-methyl-2-(1,1,1-trifluoropropan-2-yloxy)pentan-1-ol?
The InChIKey is VHDSKFXVPKJKCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18F3NO2/c1-5(2)8(13)7(4-14)15-6(3)9(10,11)12/h5-8,14H,4,13H2,1-3H3.
What are the key properties of 3-amino-4-methyl-2-(1,1,1-trifluoropropan-2-yloxy)pentan-1-ol?
3-amino-4-methyl-2-(1,1,1-trifluoropropan-2-yloxy)pentan-1-ol has a molecular weight of 229.24 g/mol, XLogP of 1.30, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-4-methyl-2-(1,1,1-trifluoropropan-2-yloxy)pentan-1-ol is sourced from PubChem (CID 114358327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).