C9H16F5NO2 — CID 114358337
3-amino-4-methyl-2-(2,2,3,3,3-pentafluoropropoxy)pentan-1-ol (PubChem CID 114358337) has the molecular formula C9H16F5NO2 and a molecular weight of 265.22 g/mol. Its IUPAC name is 3-amino-4-methyl-2-(2,2,3,3,3-pentafluoropropoxy)pentan-1-ol.
| Compound Name | 3-amino-4-methyl-2-(2,2,3,3,3-pentafluoropropoxy)pentan-1-ol |
|---|---|
| PubChem CID | 114358337 |
| Molecular Formula | C9H16F5NO2 |
| Molecular Weight | 265.22 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | 3-amino-4-methyl-2-(2,2,3,3,3-pentafluoropropoxy)pentan-1-ol |
| SMILES | CC(C)C(N)C(CO)OCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H16F5NO2/c1-5(2)7(15)6(3-16)17-4-8(10,11)9(12,13)14/h5-7,16H,3-4,15H2,1-2H3 |
| InChIKey | KSBCMKWGUXAKHY-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.22 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|