About 3-amino-2-(2,2-difluoroethoxy)-4-methylpentan-1-ol
3-amino-2-(2,2-difluoroethoxy)-4-methylpentan-1-ol (PubChem CID 114358361) has the molecular formula C8H17F2NO2
and a molecular weight of 197.22 g/mol. Its IUPAC name is 3-amino-2-(2,2-difluoroethoxy)-4-methylpentan-1-ol.
Molecular Properties
| Compound Name | 3-amino-2-(2,2-difluoroethoxy)-4-methylpentan-1-ol |
| PubChem CID | 114358361 |
| Molecular Formula | C8H17F2NO2 |
| Molecular Weight | 197.22 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | 3-amino-2-(2,2-difluoroethoxy)-4-methylpentan-1-ol |
| SMILES | CC(C)C(N)C(CO)OCC(F)F |
| InChI | InChI=1S/C8H17F2NO2/c1-5(2)8(11)6(3-12)13-4-7(9)10/h5-8,12H,3-4,11H2,1-2H3 |
| InChIKey | ZQDVNMRVQPUNEL-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.22 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-amino-2-(2,2-difluoroethoxy)-4-methylpentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-2-(2,2-difluoroethoxy)-4-methylpentan-1-ol?
The IUPAC name of 3-amino-2-(2,2-difluoroethoxy)-4-methylpentan-1-ol (CID 114358361) is 3-amino-2-(2,2-difluoroethoxy)-4-methylpentan-1-ol.
What is the SMILES notation for 3-amino-2-(2,2-difluoroethoxy)-4-methylpentan-1-ol?
The canonical SMILES for 3-amino-2-(2,2-difluoroethoxy)-4-methylpentan-1-ol is CC(C)C(N)C(CO)OCC(F)F.
What is the InChIKey of 3-amino-2-(2,2-difluoroethoxy)-4-methylpentan-1-ol?
The InChIKey is ZQDVNMRVQPUNEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17F2NO2/c1-5(2)8(11)6(3-12)13-4-7(9)10/h5-8,12H,3-4,11H2,1-2H3.
What are the key properties of 3-amino-2-(2,2-difluoroethoxy)-4-methylpentan-1-ol?
3-amino-2-(2,2-difluoroethoxy)-4-methylpentan-1-ol has a molecular weight of 197.22 g/mol, XLogP of 0.61, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-2-(2,2-difluoroethoxy)-4-methylpentan-1-ol is sourced from PubChem (CID 114358361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).