C10H16O5 — CID 11435879
methyl 3-[(4R,5S)-5-formyl-2,2-dimethyl-1,3-dioxolan-4-yl]propanoate (PubChem CID 11435879) has the molecular formula C10H16O5 and a molecular weight of 216.23 g/mol. Its IUPAC name is methyl 3-[(4R,5S)-5-formyl-2,2-dimethyl-1,3-dioxolan-4-yl]propanoate.
| Compound Name | methyl 3-[(4R,5S)-5-formyl-2,2-dimethyl-1,3-dioxolan-4-yl]propanoate |
|---|---|
| PubChem CID | 11435879 |
| Molecular Formula | C10H16O5 |
| Molecular Weight | 216.23 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | methyl 3-[(4R,5S)-5-formyl-2,2-dimethyl-1,3-dioxolan-4-yl]propanoate |
| SMILES | COC(=O)CC[C@H]1OC(C)(C)O[C@@H]1C=O |
| InChI | InChI=1S/C10H16O5/c1-10(2)14-7(8(6-11)15-10)4-5-9(12)13-3/h6-8H,4-5H2,1-3H3/t7-,8-/m1/s1 |
| InChIKey | WVOTVAIYWUMTPZ-HTQZYQBOSA-N |
| XLogP | 0.66 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.23 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|