About imino(diphenyl)-λ4-sulfane;hydrate
imino(diphenyl)-λ4-sulfane;hydrate (PubChem CID 11435938) has the molecular formula C12H13NOS
and a molecular weight of 219.31 g/mol. Its IUPAC name is imino(diphenyl)-λ4-sulfane;hydrate.
Molecular Properties
| Compound Name | imino(diphenyl)-λ4-sulfane;hydrate |
| PubChem CID | 11435938 |
| Molecular Formula | C12H13NOS |
| Molecular Weight | 219.31 g/mol |
| Exact Mass | 219.07 |
| IUPAC Name | imino(diphenyl)-λ4-sulfane;hydrate |
| SMILES | O.[H]N=S(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C12H11NS.H2O/c13-14(11-7-3-1-4-8-11)12-9-5-2-6-10-12;/h1-10,13H;1H2 |
| InChIKey | YLGYIQQZVOCMDO-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 55.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.31 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze imino(diphenyl)-λ4-sulfane;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of imino(diphenyl)-λ4-sulfane;hydrate?
The IUPAC name of imino(diphenyl)-λ4-sulfane;hydrate (CID 11435938) is imino(diphenyl)-λ4-sulfane;hydrate.
What is the SMILES notation for imino(diphenyl)-λ4-sulfane;hydrate?
The canonical SMILES for imino(diphenyl)-λ4-sulfane;hydrate is O.[H]N=S(c1ccccc1)c1ccccc1.
What is the InChIKey of imino(diphenyl)-λ4-sulfane;hydrate?
The InChIKey is YLGYIQQZVOCMDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11NS.H2O/c13-14(11-7-3-1-4-8-11)12-9-5-2-6-10-12;/h1-10,13H;1H2.
What are the key properties of imino(diphenyl)-λ4-sulfane;hydrate?
imino(diphenyl)-λ4-sulfane;hydrate has a molecular weight of 219.31 g/mol, XLogP of 2.66, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for imino(diphenyl)-λ4-sulfane;hydrate is sourced from PubChem (CID 11435938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).