About 4-(methoxymethyl)-2-(sulfamoylmethyl)-1,3-thiazole-5-carboxylic acid
4-(methoxymethyl)-2-(sulfamoylmethyl)-1,3-thiazole-5-carboxylic acid (PubChem CID 114360077) has the molecular formula C7H10N2O5S2
and a molecular weight of 266.30 g/mol. Its IUPAC name is 4-(methoxymethyl)-2-(sulfamoylmethyl)-1,3-thiazole-5-carboxylic acid.
Molecular Properties
| Compound Name | 4-(methoxymethyl)-2-(sulfamoylmethyl)-1,3-thiazole-5-carboxylic acid |
| PubChem CID | 114360077 |
| Molecular Formula | C7H10N2O5S2 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.00 |
| IUPAC Name | 4-(methoxymethyl)-2-(sulfamoylmethyl)-1,3-thiazole-5-carboxylic acid |
| SMILES | COCc1nc(CS(N)(=O)=O)sc1C(=O)O |
| InChI | InChI=1S/C7H10N2O5S2/c1-14-2-4-6(7(10)11)15-5(9-4)3-16(8,12)13/h2-3H2,1H3,(H,10,11)(H2,8,12,13) |
| InChIKey | HUZJHUQGFUROPD-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 119.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-(methoxymethyl)-2-(sulfamoylmethyl)-1,3-thiazole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(methoxymethyl)-2-(sulfamoylmethyl)-1,3-thiazole-5-carboxylic acid?
The IUPAC name of 4-(methoxymethyl)-2-(sulfamoylmethyl)-1,3-thiazole-5-carboxylic acid (CID 114360077) is 4-(methoxymethyl)-2-(sulfamoylmethyl)-1,3-thiazole-5-carboxylic acid.
What is the SMILES notation for 4-(methoxymethyl)-2-(sulfamoylmethyl)-1,3-thiazole-5-carboxylic acid?
The canonical SMILES for 4-(methoxymethyl)-2-(sulfamoylmethyl)-1,3-thiazole-5-carboxylic acid is COCc1nc(CS(N)(=O)=O)sc1C(=O)O.
What is the InChIKey of 4-(methoxymethyl)-2-(sulfamoylmethyl)-1,3-thiazole-5-carboxylic acid?
The InChIKey is HUZJHUQGFUROPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O5S2/c1-14-2-4-6(7(10)11)15-5(9-4)3-16(8,12)13/h2-3H2,1H3,(H,10,11)(H2,8,12,13).
What are the key properties of 4-(methoxymethyl)-2-(sulfamoylmethyl)-1,3-thiazole-5-carboxylic acid?
4-(methoxymethyl)-2-(sulfamoylmethyl)-1,3-thiazole-5-carboxylic acid has a molecular weight of 266.30 g/mol, XLogP of -0.22, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(methoxymethyl)-2-(sulfamoylmethyl)-1,3-thiazole-5-carboxylic acid is sourced from PubChem (CID 114360077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).