C7H8N2O3S2 — CID 11436202
6-(sulfanylmethyl)-1,6,7,8a-tetrahydro-[1,3]thiazolo[3,4-a]pyrazine-3,5,8-trione (PubChem CID 11436202) has the molecular formula C7H8N2O3S2 and a molecular weight of 232.29 g/mol. Its IUPAC name is 6-(sulfanylmethyl)-1,6,7,8a-tetrahydro-[1,3]thiazolo[3,4-a]pyrazine-3,5,8-trione.
| Compound Name | 6-(sulfanylmethyl)-1,6,7,8a-tetrahydro-[1,3]thiazolo[3,4-a]pyrazine-3,5,8-trione |
|---|---|
| PubChem CID | 11436202 |
| Molecular Formula | C7H8N2O3S2 |
| Molecular Weight | 232.29 g/mol |
| Exact Mass | 232.00 |
| IUPAC Name | 6-(sulfanylmethyl)-1,6,7,8a-tetrahydro-[1,3]thiazolo[3,4-a]pyrazine-3,5,8-trione |
| SMILES | O=C1NC(CS)C(=O)N2C(=O)SCC12 |
| InChI | InChI=1S/C7H8N2O3S2/c10-5-4-2-14-7(12)9(4)6(11)3(1-13)8-5/h3-4,13H,1-2H2,(H,8,10) |
| InChIKey | BFFYPOPPPUWONN-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.29 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|