About 2-iodo-4,6-dimethylpyrimidine
2-iodo-4,6-dimethylpyrimidine (PubChem CID 11436236) has the molecular formula C6H7IN2
and a molecular weight of 234.04 g/mol. Its IUPAC name is 2-iodo-4,6-dimethylpyrimidine.
Molecular Properties
| Compound Name | 2-iodo-4,6-dimethylpyrimidine |
| PubChem CID | 11436236 |
| Molecular Formula | C6H7IN2 |
| Molecular Weight | 234.04 g/mol |
| Exact Mass | 233.97 |
| IUPAC Name | 2-iodo-4,6-dimethylpyrimidine |
| SMILES | Cc1cc(C)nc(I)n1 |
| InChI | InChI=1S/C6H7IN2/c1-4-3-5(2)9-6(7)8-4/h3H,1-2H3 |
| InChIKey | HYQMOIDHGGDJMH-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.04 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-iodo-4,6-dimethylpyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-iodo-4,6-dimethylpyrimidine?
The IUPAC name of 2-iodo-4,6-dimethylpyrimidine (CID 11436236) is 2-iodo-4,6-dimethylpyrimidine.
What is the SMILES notation for 2-iodo-4,6-dimethylpyrimidine?
The canonical SMILES for 2-iodo-4,6-dimethylpyrimidine is Cc1cc(C)nc(I)n1.
What is the InChIKey of 2-iodo-4,6-dimethylpyrimidine?
The InChIKey is HYQMOIDHGGDJMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7IN2/c1-4-3-5(2)9-6(7)8-4/h3H,1-2H3.
What are the key properties of 2-iodo-4,6-dimethylpyrimidine?
2-iodo-4,6-dimethylpyrimidine has a molecular weight of 234.04 g/mol, XLogP of 1.70, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-iodo-4,6-dimethylpyrimidine is sourced from PubChem (CID 11436236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).