C15H17F3N2S — CID 114362417
1-[4-tert-butyl-2-(3,4,5-trifluorophenyl)-1,3-thiazol-5-yl]-N-methylmethanamine (PubChem CID 114362417) has the molecular formula C15H17F3N2S and a molecular weight of 314.38 g/mol. Its IUPAC name is 1-[4-tert-butyl-2-(3,4,5-trifluorophenyl)-1,3-thiazol-5-yl]-N-methylmethanamine.
| Compound Name | 1-[4-tert-butyl-2-(3,4,5-trifluorophenyl)-1,3-thiazol-5-yl]-N-methylmethanamine |
|---|---|
| PubChem CID | 114362417 |
| Molecular Formula | C15H17F3N2S |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | 1-[4-tert-butyl-2-(3,4,5-trifluorophenyl)-1,3-thiazol-5-yl]-N-methylmethanamine |
| SMILES | CNCc1sc(-c2cc(F)c(F)c(F)c2)nc1C(C)(C)C |
| InChI | InChI=1S/C15H17F3N2S/c1-15(2,3)13-11(7-19-4)21-14(20-13)8-5-9(16)12(18)10(17)6-8/h5-6,19H,7H2,1-4H3 |
| InChIKey | CMBZQWHIJBPDFK-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|