C14H19BrClNO2S2 — CID 114363719
4-[2-bromo-5-(chloromethyl)-3-methylphenyl]sulfonyl-2,3-dimethylthiomorpholine (PubChem CID 114363719) has the molecular formula C14H19BrClNO2S2 and a molecular weight of 412.80 g/mol. Its IUPAC name is 4-[2-bromo-5-(chloromethyl)-3-methylphenyl]sulfonyl-2,3-dimethylthiomorpholine.
| Compound Name | 4-[2-bromo-5-(chloromethyl)-3-methylphenyl]sulfonyl-2,3-dimethylthiomorpholine |
|---|---|
| PubChem CID | 114363719 |
| Molecular Formula | C14H19BrClNO2S2 |
| Molecular Weight | 412.80 g/mol |
| Exact Mass | 410.97 |
| IUPAC Name | 4-[2-bromo-5-(chloromethyl)-3-methylphenyl]sulfonyl-2,3-dimethylthiomorpholine |
| SMILES | Cc1cc(CCl)cc(S(=O)(=O)N2CCSC(C)C2C)c1Br |
| InChI | InChI=1S/C14H19BrClNO2S2/c1-9-6-12(8-16)7-13(14(9)15)21(18,19)17-4-5-20-11(3)10(17)2/h6-7,10-11H,4-5,8H2,1-3H3 |
| InChIKey | RKXKVMRJQRPBHB-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.80 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|