C16H28N2S3 — CID 114363903
N-[[2-(3-ethyl-1,4-dithian-2-yl)-4-propyl-1,3-thiazol-5-yl]methyl]propan-1-amine (PubChem CID 114363903) has the molecular formula C16H28N2S3 and a molecular weight of 344.62 g/mol. Its IUPAC name is N-[[2-(3-ethyl-1,4-dithian-2-yl)-4-propyl-1,3-thiazol-5-yl]methyl]propan-1-amine.
| Compound Name | N-[[2-(3-ethyl-1,4-dithian-2-yl)-4-propyl-1,3-thiazol-5-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 114363903 |
| Molecular Formula | C16H28N2S3 |
| Molecular Weight | 344.62 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | N-[[2-(3-ethyl-1,4-dithian-2-yl)-4-propyl-1,3-thiazol-5-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1sc(C2SCCSC2CC)nc1CCC |
| InChI | InChI=1S/C16H28N2S3/c1-4-7-12-14(11-17-8-5-2)21-16(18-12)15-13(6-3)19-9-10-20-15/h13,15,17H,4-11H2,1-3H3 |
| InChIKey | NJHPJBUKUQYVJY-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.62 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|