About 5H-benzo[b]carbazole-6,11-dione
5H-benzo[b]carbazole-6,11-dione (PubChem CID 11436556) has the molecular formula C16H9NO2
and a molecular weight of 247.25 g/mol. Its IUPAC name is 5H-benzo[b]carbazole-6,11-dione.
Molecular Properties
| Compound Name | 5H-benzo[b]carbazole-6,11-dione |
| PubChem CID | 11436556 |
| Molecular Formula | C16H9NO2 |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.06 |
| IUPAC Name | 5H-benzo[b]carbazole-6,11-dione |
| SMILES | O=C1c2ccccc2C(=O)c2c1[nH]c1ccccc21 |
| InChI | InChI=1S/C16H9NO2/c18-15-9-5-1-2-6-10(9)16(19)14-13(15)11-7-3-4-8-12(11)17-14/h1-8,17H |
| InChIKey | MUFKSKNPYXEXIH-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 49.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze 5H-benzo[b]carbazole-6,11-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5H-benzo[b]carbazole-6,11-dione?
The IUPAC name of 5H-benzo[b]carbazole-6,11-dione (CID 11436556) is 5H-benzo[b]carbazole-6,11-dione.
What is the SMILES notation for 5H-benzo[b]carbazole-6,11-dione?
The canonical SMILES for 5H-benzo[b]carbazole-6,11-dione is O=C1c2ccccc2C(=O)c2c1[nH]c1ccccc21.
What is the InChIKey of 5H-benzo[b]carbazole-6,11-dione?
The InChIKey is MUFKSKNPYXEXIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H9NO2/c18-15-9-5-1-2-6-10(9)16(19)14-13(15)11-7-3-4-8-12(11)17-14/h1-8,17H.
What are the key properties of 5H-benzo[b]carbazole-6,11-dione?
5H-benzo[b]carbazole-6,11-dione has a molecular weight of 247.25 g/mol, XLogP of 2.94, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5H-benzo[b]carbazole-6,11-dione is sourced from PubChem (CID 11436556), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).