C15H23BrN2O2S — CID 114365770
2-bromo-5-(ethylaminomethyl)-N,3-dimethyl-N-(2-methylprop-2-enyl)benzenesulfonamide (PubChem CID 114365770) has the molecular formula C15H23BrN2O2S and a molecular weight of 375.33 g/mol. Its IUPAC name is 2-bromo-5-(ethylaminomethyl)-N,3-dimethyl-N-(2-methylprop-2-enyl)benzenesulfonamide.
| Compound Name | 2-bromo-5-(ethylaminomethyl)-N,3-dimethyl-N-(2-methylprop-2-enyl)benzenesulfonamide |
|---|---|
| PubChem CID | 114365770 |
| Molecular Formula | C15H23BrN2O2S |
| Molecular Weight | 375.33 g/mol |
| Exact Mass | 374.07 |
| IUPAC Name | 2-bromo-5-(ethylaminomethyl)-N,3-dimethyl-N-(2-methylprop-2-enyl)benzenesulfonamide |
| SMILES | C=C(C)CN(C)S(=O)(=O)c1cc(CNCC)cc(C)c1Br |
| InChI | InChI=1S/C15H23BrN2O2S/c1-6-17-9-13-7-12(4)15(16)14(8-13)21(19,20)18(5)10-11(2)3/h7-8,17H,2,6,9-10H2,1,3-5H3 |
| InChIKey | FEXILQWLXWCWBZ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.33 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|