C14H10Br2N2O3 — CID 114367733
5-amino-2-[(2,5-dibromobenzoyl)amino]benzoic acid (PubChem CID 114367733) has the molecular formula C14H10Br2N2O3 and a molecular weight of 414.05 g/mol. Its IUPAC name is 5-amino-2-[(2,5-dibromobenzoyl)amino]benzoic acid.
| Compound Name | 5-amino-2-[(2,5-dibromobenzoyl)amino]benzoic acid |
|---|---|
| PubChem CID | 114367733 |
| Molecular Formula | C14H10Br2N2O3 |
| Molecular Weight | 414.05 g/mol |
| Exact Mass | 411.91 |
| IUPAC Name | 5-amino-2-[(2,5-dibromobenzoyl)amino]benzoic acid |
| SMILES | Nc1ccc(NC(=O)c2cc(Br)ccc2Br)c(C(=O)O)c1 |
| InChI | InChI=1S/C14H10Br2N2O3/c15-7-1-3-11(16)9(5-7)13(19)18-12-4-2-8(17)6-10(12)14(20)21/h1-6H,17H2,(H,18,19)(H,20,21) |
| InChIKey | KGCHRAYVRQTRCS-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.05 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|