C12H15ClO4 — CID 11436840
ethyl (2S,3R)-2-(4-chlorophenoxy)-3-hydroxybutanoate (PubChem CID 11436840) has the molecular formula C12H15ClO4 and a molecular weight of 258.70 g/mol. Its IUPAC name is ethyl (2S,3R)-2-(4-chlorophenoxy)-3-hydroxybutanoate.
| Compound Name | ethyl (2S,3R)-2-(4-chlorophenoxy)-3-hydroxybutanoate |
|---|---|
| PubChem CID | 11436840 |
| Molecular Formula | C12H15ClO4 |
| Molecular Weight | 258.70 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | ethyl (2S,3R)-2-(4-chlorophenoxy)-3-hydroxybutanoate |
| SMILES | CCOC(=O)[C@@H](Oc1ccc(Cl)cc1)[C@@H](C)O |
| InChI | InChI=1S/C12H15ClO4/c1-3-16-12(15)11(8(2)14)17-10-6-4-9(13)5-7-10/h4-8,11,14H,3H2,1-2H3/t8-,11+/m1/s1 |
| InChIKey | YKDDRVBXECKGDI-KCJUWKMLSA-N |
| XLogP | 2.03 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.70 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |