About N-[[4-(2-methylpropyl)-1,3-thiazol-5-yl]methyl]ethanamine
N-[[4-(2-methylpropyl)-1,3-thiazol-5-yl]methyl]ethanamine (PubChem CID 114368513) has the molecular formula C10H18N2S
and a molecular weight of 198.33 g/mol. Its IUPAC name is N-[[4-(2-methylpropyl)-1,3-thiazol-5-yl]methyl]ethanamine.
Molecular Properties
| Compound Name | N-[[4-(2-methylpropyl)-1,3-thiazol-5-yl]methyl]ethanamine |
| PubChem CID | 114368513 |
| Molecular Formula | C10H18N2S |
| Molecular Weight | 198.33 g/mol |
| Exact Mass | 198.12 |
| IUPAC Name | N-[[4-(2-methylpropyl)-1,3-thiazol-5-yl]methyl]ethanamine |
| SMILES | CCNCc1scnc1CC(C)C |
| InChI | InChI=1S/C10H18N2S/c1-4-11-6-10-9(5-8(2)3)12-7-13-10/h7-8,11H,4-6H2,1-3H3 |
| InChIKey | MFCNOYQFAFPMBK-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.33 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[[4-(2-methylpropyl)-1,3-thiazol-5-yl]methyl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[4-(2-methylpropyl)-1,3-thiazol-5-yl]methyl]ethanamine?
The IUPAC name of N-[[4-(2-methylpropyl)-1,3-thiazol-5-yl]methyl]ethanamine (CID 114368513) is N-[[4-(2-methylpropyl)-1,3-thiazol-5-yl]methyl]ethanamine.
What is the SMILES notation for N-[[4-(2-methylpropyl)-1,3-thiazol-5-yl]methyl]ethanamine?
The canonical SMILES for N-[[4-(2-methylpropyl)-1,3-thiazol-5-yl]methyl]ethanamine is CCNCc1scnc1CC(C)C.
What is the InChIKey of N-[[4-(2-methylpropyl)-1,3-thiazol-5-yl]methyl]ethanamine?
The InChIKey is MFCNOYQFAFPMBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2S/c1-4-11-6-10-9(5-8(2)3)12-7-13-10/h7-8,11H,4-6H2,1-3H3.
What are the key properties of N-[[4-(2-methylpropyl)-1,3-thiazol-5-yl]methyl]ethanamine?
N-[[4-(2-methylpropyl)-1,3-thiazol-5-yl]methyl]ethanamine has a molecular weight of 198.33 g/mol, XLogP of 2.45, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[4-(2-methylpropyl)-1,3-thiazol-5-yl]methyl]ethanamine is sourced from PubChem (CID 114368513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).