C17H32N2OS — CID 114368822
N-[[2-(3-methoxypentan-3-yl)-4-(2-methylpropyl)-1,3-thiazol-5-yl]methyl]propan-1-amine (PubChem CID 114368822) has the molecular formula C17H32N2OS and a molecular weight of 312.52 g/mol. Its IUPAC name is N-[[2-(3-methoxypentan-3-yl)-4-(2-methylpropyl)-1,3-thiazol-5-yl]methyl]propan-1-amine.
| Compound Name | N-[[2-(3-methoxypentan-3-yl)-4-(2-methylpropyl)-1,3-thiazol-5-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 114368822 |
| Molecular Formula | C17H32N2OS |
| Molecular Weight | 312.52 g/mol |
| Exact Mass | 312.22 |
| IUPAC Name | N-[[2-(3-methoxypentan-3-yl)-4-(2-methylpropyl)-1,3-thiazol-5-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1sc(C(CC)(CC)OC)nc1CC(C)C |
| InChI | InChI=1S/C17H32N2OS/c1-7-10-18-12-15-14(11-13(4)5)19-16(21-15)17(8-2,9-3)20-6/h13,18H,7-12H2,1-6H3 |
| InChIKey | MYZFXOYZPSISKW-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.52 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|