About diethyl [(1S,2R)-2-ethylcyclohex-3-en-1-yl] phosphate
diethyl [(1S,2R)-2-ethylcyclohex-3-en-1-yl] phosphate (PubChem CID 11436945) has the molecular formula C12H23O4P
and a molecular weight of 262.29 g/mol. Its IUPAC name is diethyl [(1S,2R)-2-ethylcyclohex-3-en-1-yl] phosphate.
Molecular Properties
| Compound Name | diethyl [(1S,2R)-2-ethylcyclohex-3-en-1-yl] phosphate |
| PubChem CID | 11436945 |
| Molecular Formula | C12H23O4P |
| Molecular Weight | 262.29 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | diethyl [(1S,2R)-2-ethylcyclohex-3-en-1-yl] phosphate |
| SMILES | CCOP(=O)(OCC)O[C@H]1CCC=C[C@H]1CC |
| InChI | InChI=1S/C12H23O4P/c1-4-11-9-7-8-10-12(11)16-17(13,14-5-2)15-6-3/h7,9,11-12H,4-6,8,10H2,1-3H3/t11-,12+/m1/s1 |
| InChIKey | FNPJWEWOISYREZ-NEPJUHHUSA-N |
| XLogP | 3.93 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.29 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze diethyl [(1S,2R)-2-ethylcyclohex-3-en-1-yl] phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl [(1S,2R)-2-ethylcyclohex-3-en-1-yl] phosphate?
The IUPAC name of diethyl [(1S,2R)-2-ethylcyclohex-3-en-1-yl] phosphate (CID 11436945) is diethyl [(1S,2R)-2-ethylcyclohex-3-en-1-yl] phosphate.
What is the SMILES notation for diethyl [(1S,2R)-2-ethylcyclohex-3-en-1-yl] phosphate?
The canonical SMILES for diethyl [(1S,2R)-2-ethylcyclohex-3-en-1-yl] phosphate is CCOP(=O)(OCC)O[C@H]1CCC=C[C@H]1CC.
What is the InChIKey of diethyl [(1S,2R)-2-ethylcyclohex-3-en-1-yl] phosphate?
The InChIKey is FNPJWEWOISYREZ-NEPJUHHUSA-N. The full InChI is InChI=1S/C12H23O4P/c1-4-11-9-7-8-10-12(11)16-17(13,14-5-2)15-6-3/h7,9,11-12H,4-6,8,10H2,1-3H3/t11-,12+/m1/s1.
What are the key properties of diethyl [(1S,2R)-2-ethylcyclohex-3-en-1-yl] phosphate?
diethyl [(1S,2R)-2-ethylcyclohex-3-en-1-yl] phosphate has a molecular weight of 262.29 g/mol, XLogP of 3.93, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl [(1S,2R)-2-ethylcyclohex-3-en-1-yl] phosphate is sourced from PubChem (CID 11436945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).