About 5,12-dimethyl-[1,4]benzodioxino[2,3-g]isoquinoline
5,12-dimethyl-[1,4]benzodioxino[2,3-g]isoquinoline (PubChem CID 11436978) has the molecular formula C17H13NO2
and a molecular weight of 263.30 g/mol. Its IUPAC name is 5,12-dimethyl-[1,4]benzodioxino[2,3-g]isoquinoline.
Molecular Properties
| Compound Name | 5,12-dimethyl-[1,4]benzodioxino[2,3-g]isoquinoline |
| PubChem CID | 11436978 |
| Molecular Formula | C17H13NO2 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | 5,12-dimethyl-[1,4]benzodioxino[2,3-g]isoquinoline |
| SMILES | Cc1c2c(c(C)c3cnccc13)Oc1ccccc1O2 |
| InChI | InChI=1S/C17H13NO2/c1-10-12-7-8-18-9-13(12)11(2)17-16(10)19-14-5-3-4-6-15(14)20-17/h3-9H,1-2H3 |
| InChIKey | GOLRTZAKBMGUEZ-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5,12-dimethyl-[1,4]benzodioxino[2,3-g]isoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,12-dimethyl-[1,4]benzodioxino[2,3-g]isoquinoline?
The IUPAC name of 5,12-dimethyl-[1,4]benzodioxino[2,3-g]isoquinoline (CID 11436978) is 5,12-dimethyl-[1,4]benzodioxino[2,3-g]isoquinoline.
What is the SMILES notation for 5,12-dimethyl-[1,4]benzodioxino[2,3-g]isoquinoline?
The canonical SMILES for 5,12-dimethyl-[1,4]benzodioxino[2,3-g]isoquinoline is Cc1c2c(c(C)c3cnccc13)Oc1ccccc1O2.
What is the InChIKey of 5,12-dimethyl-[1,4]benzodioxino[2,3-g]isoquinoline?
The InChIKey is GOLRTZAKBMGUEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13NO2/c1-10-12-7-8-18-9-13(12)11(2)17-16(10)19-14-5-3-4-6-15(14)20-17/h3-9H,1-2H3.
What are the key properties of 5,12-dimethyl-[1,4]benzodioxino[2,3-g]isoquinoline?
5,12-dimethyl-[1,4]benzodioxino[2,3-g]isoquinoline has a molecular weight of 263.30 g/mol, XLogP of 4.75, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,12-dimethyl-[1,4]benzodioxino[2,3-g]isoquinoline is sourced from PubChem (CID 11436978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).