C9H19NO4S — CID 114369912
methyl 3-(3-amino-1-hydroxy-4-methoxybutan-2-yl)sulfanylpropanoate (PubChem CID 114369912) has the molecular formula C9H19NO4S and a molecular weight of 237.32 g/mol. Its IUPAC name is methyl 3-(3-amino-1-hydroxy-4-methoxybutan-2-yl)sulfanylpropanoate.
| Compound Name | methyl 3-(3-amino-1-hydroxy-4-methoxybutan-2-yl)sulfanylpropanoate |
|---|---|
| PubChem CID | 114369912 |
| Molecular Formula | C9H19NO4S |
| Molecular Weight | 237.32 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | methyl 3-(3-amino-1-hydroxy-4-methoxybutan-2-yl)sulfanylpropanoate |
| SMILES | COCC(N)C(CO)SCCC(=O)OC |
| InChI | InChI=1S/C9H19NO4S/c1-13-6-7(10)8(5-11)15-4-3-9(12)14-2/h7-8,11H,3-6,10H2,1-2H3 |
| InChIKey | IXVCVMMNQAGDSF-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.32 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |