C15H22O4 — CID 11437050
ethyl 2-[(3aR,6aS)-2,5,5-trimethyl-1,3-dioxo-3a,4,6,6a-tetrahydropentalen-2-yl]acetate (PubChem CID 11437050) has the molecular formula C15H22O4 and a molecular weight of 266.34 g/mol. Its IUPAC name is ethyl 2-[(3aR,6aS)-2,5,5-trimethyl-1,3-dioxo-3a,4,6,6a-tetrahydropentalen-2-yl]acetate.
| Compound Name | ethyl 2-[(3aR,6aS)-2,5,5-trimethyl-1,3-dioxo-3a,4,6,6a-tetrahydropentalen-2-yl]acetate |
|---|---|
| PubChem CID | 11437050 |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | ethyl 2-[(3aR,6aS)-2,5,5-trimethyl-1,3-dioxo-3a,4,6,6a-tetrahydropentalen-2-yl]acetate |
| SMILES | CCOC(=O)CC1(C)C(=O)[C@H]2CC(C)(C)C[C@H]2C1=O |
| InChI | InChI=1S/C15H22O4/c1-5-19-11(16)8-15(4)12(17)9-6-14(2,3)7-10(9)13(15)18/h9-10H,5-8H2,1-4H3/t9-,10+,15? |
| InChIKey | NNZHQYFVSNQVGP-WYPFBEBGSA-N |
| XLogP | 2.15 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|