About 3-amino-4,4-dimethyl-2-(1-methylpyrazol-4-yl)sulfanylpentan-1-ol
3-amino-4,4-dimethyl-2-(1-methylpyrazol-4-yl)sulfanylpentan-1-ol (PubChem CID 114370571) has the molecular formula C11H21N3OS
and a molecular weight of 243.38 g/mol. Its IUPAC name is 3-amino-4,4-dimethyl-2-(1-methylpyrazol-4-yl)sulfanylpentan-1-ol.
Molecular Properties
| Compound Name | 3-amino-4,4-dimethyl-2-(1-methylpyrazol-4-yl)sulfanylpentan-1-ol |
| PubChem CID | 114370571 |
| Molecular Formula | C11H21N3OS |
| Molecular Weight | 243.38 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | 3-amino-4,4-dimethyl-2-(1-methylpyrazol-4-yl)sulfanylpentan-1-ol |
| SMILES | Cn1cc(SC(CO)C(N)C(C)(C)C)cn1 |
| InChI | InChI=1S/C11H21N3OS/c1-11(2,3)10(12)9(7-15)16-8-5-13-14(4)6-8/h5-6,9-10,15H,7,12H2,1-4H3 |
| InChIKey | DUJKEUGQOZVAAV-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.38 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-amino-4,4-dimethyl-2-(1-methylpyrazol-4-yl)sulfanylpentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-4,4-dimethyl-2-(1-methylpyrazol-4-yl)sulfanylpentan-1-ol?
The IUPAC name of 3-amino-4,4-dimethyl-2-(1-methylpyrazol-4-yl)sulfanylpentan-1-ol (CID 114370571) is 3-amino-4,4-dimethyl-2-(1-methylpyrazol-4-yl)sulfanylpentan-1-ol.
What is the SMILES notation for 3-amino-4,4-dimethyl-2-(1-methylpyrazol-4-yl)sulfanylpentan-1-ol?
The canonical SMILES for 3-amino-4,4-dimethyl-2-(1-methylpyrazol-4-yl)sulfanylpentan-1-ol is Cn1cc(SC(CO)C(N)C(C)(C)C)cn1.
What is the InChIKey of 3-amino-4,4-dimethyl-2-(1-methylpyrazol-4-yl)sulfanylpentan-1-ol?
The InChIKey is DUJKEUGQOZVAAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21N3OS/c1-11(2,3)10(12)9(7-15)16-8-5-13-14(4)6-8/h5-6,9-10,15H,7,12H2,1-4H3.
What are the key properties of 3-amino-4,4-dimethyl-2-(1-methylpyrazol-4-yl)sulfanylpentan-1-ol?
3-amino-4,4-dimethyl-2-(1-methylpyrazol-4-yl)sulfanylpentan-1-ol has a molecular weight of 243.38 g/mol, XLogP of 1.25, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-4,4-dimethyl-2-(1-methylpyrazol-4-yl)sulfanylpentan-1-ol is sourced from PubChem (CID 114370571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).