About ethyl 2-tert-butyl-4-propan-2-yl-1,3-oxazole-5-carboxylate
ethyl 2-tert-butyl-4-propan-2-yl-1,3-oxazole-5-carboxylate (PubChem CID 114371351) has the molecular formula C13H21NO3
and a molecular weight of 239.31 g/mol. Its IUPAC name is ethyl 2-tert-butyl-4-propan-2-yl-1,3-oxazole-5-carboxylate.
Analyze ethyl 2-tert-butyl-4-propan-2-yl-1,3-oxazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-tert-butyl-4-propan-2-yl-1,3-oxazole-5-carboxylate?
The IUPAC name of ethyl 2-tert-butyl-4-propan-2-yl-1,3-oxazole-5-carboxylate (CID 114371351) is ethyl 2-tert-butyl-4-propan-2-yl-1,3-oxazole-5-carboxylate.
What is the SMILES notation for ethyl 2-tert-butyl-4-propan-2-yl-1,3-oxazole-5-carboxylate?
The canonical SMILES for ethyl 2-tert-butyl-4-propan-2-yl-1,3-oxazole-5-carboxylate is CCOC(=O)c1oc(C(C)(C)C)nc1C(C)C.
What is the InChIKey of ethyl 2-tert-butyl-4-propan-2-yl-1,3-oxazole-5-carboxylate?
The InChIKey is ZEHMZMKZPMEUBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21NO3/c1-7-16-11(15)10-9(8(2)3)14-12(17-10)13(4,5)6/h8H,7H2,1-6H3.
What are the key properties of ethyl 2-tert-butyl-4-propan-2-yl-1,3-oxazole-5-carboxylate?
ethyl 2-tert-butyl-4-propan-2-yl-1,3-oxazole-5-carboxylate has a molecular weight of 239.31 g/mol, XLogP of 3.27, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-tert-butyl-4-propan-2-yl-1,3-oxazole-5-carboxylate is sourced from PubChem (CID 114371351), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).