C14H17Br2NO — CID 114372364
2,5-dibromo-N-[(1-methylcyclopentyl)methyl]benzamide (PubChem CID 114372364) has the molecular formula C14H17Br2NO and a molecular weight of 375.10 g/mol. Its IUPAC name is 2,5-dibromo-N-[(1-methylcyclopentyl)methyl]benzamide.
| Compound Name | 2,5-dibromo-N-[(1-methylcyclopentyl)methyl]benzamide |
|---|---|
| PubChem CID | 114372364 |
| Molecular Formula | C14H17Br2NO |
| Molecular Weight | 375.10 g/mol |
| Exact Mass | 372.97 |
| IUPAC Name | 2,5-dibromo-N-[(1-methylcyclopentyl)methyl]benzamide |
| SMILES | CC1(CNC(=O)c2cc(Br)ccc2Br)CCCC1 |
| InChI | InChI=1S/C14H17Br2NO/c1-14(6-2-3-7-14)9-17-13(18)11-8-10(15)4-5-12(11)16/h4-5,8H,2-3,6-7,9H2,1H3,(H,17,18) |
| InChIKey | DXMFPIZCKUVHBG-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.10 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |