About 2,5-dibromo-N-(1-methyl-2,6-dioxopiperidin-3-yl)benzamide
2,5-dibromo-N-(1-methyl-2,6-dioxopiperidin-3-yl)benzamide (PubChem CID 114372512) has the molecular formula C13H12Br2N2O3
and a molecular weight of 404.06 g/mol. Its IUPAC name is 2,5-dibromo-N-(1-methyl-2,6-dioxopiperidin-3-yl)benzamide.
Molecular Properties
| Compound Name | 2,5-dibromo-N-(1-methyl-2,6-dioxopiperidin-3-yl)benzamide |
| PubChem CID | 114372512 |
| Molecular Formula | C13H12Br2N2O3 |
| Molecular Weight | 404.06 g/mol |
| Exact Mass | 401.92 |
| IUPAC Name | 2,5-dibromo-N-(1-methyl-2,6-dioxopiperidin-3-yl)benzamide |
| SMILES | CN1C(=O)CCC(NC(=O)c2cc(Br)ccc2Br)C1=O |
| InChI | InChI=1S/C13H12Br2N2O3/c1-17-11(18)5-4-10(13(17)20)16-12(19)8-6-7(14)2-3-9(8)15/h2-3,6,10H,4-5H2,1H3,(H,16,19) |
| InChIKey | FISFRCFOIFXREU-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.06 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2,5-dibromo-N-(1-methyl-2,6-dioxopiperidin-3-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dibromo-N-(1-methyl-2,6-dioxopiperidin-3-yl)benzamide?
The IUPAC name of 2,5-dibromo-N-(1-methyl-2,6-dioxopiperidin-3-yl)benzamide (CID 114372512) is 2,5-dibromo-N-(1-methyl-2,6-dioxopiperidin-3-yl)benzamide.
What is the SMILES notation for 2,5-dibromo-N-(1-methyl-2,6-dioxopiperidin-3-yl)benzamide?
The canonical SMILES for 2,5-dibromo-N-(1-methyl-2,6-dioxopiperidin-3-yl)benzamide is CN1C(=O)CCC(NC(=O)c2cc(Br)ccc2Br)C1=O.
What is the InChIKey of 2,5-dibromo-N-(1-methyl-2,6-dioxopiperidin-3-yl)benzamide?
The InChIKey is FISFRCFOIFXREU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12Br2N2O3/c1-17-11(18)5-4-10(13(17)20)16-12(19)8-6-7(14)2-3-9(8)15/h2-3,6,10H,4-5H2,1H3,(H,16,19).
What are the key properties of 2,5-dibromo-N-(1-methyl-2,6-dioxopiperidin-3-yl)benzamide?
2,5-dibromo-N-(1-methyl-2,6-dioxopiperidin-3-yl)benzamide has a molecular weight of 404.06 g/mol, XLogP of 2.09, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dibromo-N-(1-methyl-2,6-dioxopiperidin-3-yl)benzamide is sourced from PubChem (CID 114372512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).